Daylight Worksheet - SMARTS Practice ...SHOW HINTS (ANSWERS)!

The following smiles training set may be used for matching against for the smarts exercises. For each smarts assigned, at least one match exists in the following molecules.

CN1C(=O)N(C)C(=O)C(N(C)C=N2)=C12 caffeine
c1ncccc1C1CCCN1C nicotine
c1ccccc1C(=O)OC2CC(N3C)CCC3C2C(=O)OC cocaine
CCN(CC)C(=O)C1CN(C)C2CC3=CNc(ccc4)c3c4C2=C1 LSD
N12CCC36C1CC(C(C2)=CCOC4CC5=O)C4C3N5c7ccccc76 Strychnine
COc1cc2c(ccnc2cc1)C(O)C4CC(CC3)C(C=C)CN34 quinine
C123C5C(O)C=CC2C(N(C)CC1)Cc(ccc4O)c3c4O5 morphine
C123C5C(OC(=O)C)C=CC2C(N(C)CC1)Cc(ccc4OC(=O)C)c3c4O5 heroin
C1C(C)=C(C=CC(C)=CC=CC(C)=CCO)C(C)(C)C1 vitamin a
CC1(C)SC2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)O benzylpenicillin
[Cl-].[Cl-].NC(=O)c2cc[n+](COC[n+]1ccccc1C=NO)cc2 HI-6 
OC(=O)c1cccc(Cl)c1Cl 50-45-3

Open a separate browser and run depictmatch.cgi to test your answers by matching against the smiles above.

Write SMARTS for the descriptions given below.

1. aliphatic carbon attached to oxygen with any bond

2. non-ring atom

3. acylic-bond

4. any carbon attached to any halogen

5. oxygen or nitrogen, with at least one hydrogen attached and not in a ring

6. oxygen double bonded to aliphatic carbon or nitrogen

7. oxygen double bonded to aliphatic carbon or nitrogen, single bonded to an aromatic ring, with a halogen in meta position

8. any aliphatic atom single-bonded to any carbon which isn't a trifluromethyl carbon

• SMARTS atomic primitives
  
• SMARTS bond primitives
  
• SMARTS boolean operators