The Chemistry Cartridge adds the LOOKFOR operator to SQL. When applied to a SMILES-containing column in a table, rows containing the exactly the same structure as a given SMILES will be selected. This is a fast search which is done by indexed (hashed) retrieval. Other examples are also available.
TO_CHAR(SYSDATE,'MM: -------------------- 10:22:1998, 12:50:23 Elapsed: 00:00:00.00 old 1: select compound_id, smiles from COMPOUND_118616 where LookFor(smiles,'&1')=1 new 1: select compound_id, smiles from COMPOUND_118616 where LookFor(smiles,'CC(=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C)C=CC=C(C)C=CC2=C(C)CCCC2(C)C')=1 ID SMILES ------- ------------------------------------------------------------------------ 46634 CC(=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C)C=CC=C(C)C=CC2=C(C)CCCC2(C)C Elapsed: 00:00:00.15 TO_CHAR(SYSDATE,'MM: -------------------- 10:22:1998, 12:50:23