The Chemistry Cartridge adds chemical functionality to the SQL CONTAINS operator. When applied to a SMILES-containing column, structures may be selected which contain a substructure which is given as a SMILES. This is the classic "substructure search". WARNING: Searching for superstructures of common substructures like CCC is not advised: it will take a long time, produce a lot of output, and the results will not be very interesting. Other examples are also available.
TO_CHAR(SYSDATE,'MM: -------------------- 10:22:1998, 12:49:05 Elapsed: 00:00:00.01 old 2: where Contains(smiles,'&1')=1 new 2: where Contains(smiles,'CC(=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C)C=CC=C(C)C=CC2=C(C)CCCC2(C)C')=1 ID SMILES ------- -------------------------------------------------------------------------------- 16714 CC(=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)C(=O)CCC1(C)C)C=CC=C(C)C=CC2=C(C)C(=O)CCC2(C)C 46634 CC(=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C)C=CC=C(C)C=CC2=C(C)CCCC2(C)C Elapsed: 00:00:00.77 TO_CHAR(SYSDATE,'MM: -------------------- 10:22:1998, 12:49:06